| Name |
O-Methylfumarophycine (-)-O-Methylfumarophycine Fumaricine acetate O-Acetylfumaricine |
| Formula |
C23H25NO6 |
| Mw |
411.16818754 |
| CAS RN |
36017-45-5 |
| C_ID |
C00027452
, 
|
| InChIKey |
HTLXWDJBTOCUFB-VUEPYQETNA-N |
| InChICode |
InChI=1S/C23H25NO6/c1-13(25)30-22-20-15(5-6-17-21(20)29-12-28-17)11-23(22)16-10-19(27-4)18(26-3)9-14(16)7-8-24(23)2/h5-6,9-10,22H,7-8,11-12H2,1-4H3/t22-,23+/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@]1(Cc3ccc4c(c3[C@H]1OC(C)=O)OCO4)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Fumaria bastardii | Ref. |
| Plantae | Fumariaceae | Fumaria capreolate | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria muralis | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
|
|
zoom in
| Organism | Fumaria muralis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|