| Name |
N-Methyltyramine |
| Formula |
C9H13NO |
| Mw |
151.09971404 |
| CAS RN |
370-98-9 |
| C_ID |
C00027432
, 
|
| InChIKey |
AXVZFRBSCNEKPQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H13NO/c1-10-7-6-8-2-4-9(11)5-3-8/h2-5,10-11H,6-7H2,1H3 |
| SMILES |
CNCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe ballyi  | Ref. |
| Plantae | Asphodelaceae | Aloe deltoideodonta | Ref. |
| Plantae | Asphodelaceae | Aloe gillilandii | Ref. |
| Plantae | Asphodelaceae | Aloe ibitiensis | Ref. |
| Plantae | Asphodelaceae | Aloe ruspoliana | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asphodelaceae | Aloe viguieri | Ref. |
| Plantae | Cactaceae | Ariocarpus kotschoubeyanus | Ref. |
| Plantae | Cactaceae | Ariocarpus scapharostrus | Ref. |
| Plantae | Cactaceae | Espostoa huanucensis | Ref. |
| Plantae | Cactaceae | Mammillaria microcarpa | Ref. |
| Plantae | Cactaceae | Trichocereus candicans | Ref. |
| Plantae | Cactaceae | Trichocereus spachianus | Ref. |
| Plantae | Cactaceae | Turbinicarpus alonsoi | Ref. |
| Plantae | Fabaceae | Acacia rigidula Benth. | Ref. |
| Plantae | Fabaceae | Desmodium gangeticum  | Ref. |
| Plantae | Fabaceae | Prosopis glandulosa  | Ref. |
| Plantae | Poaceae | Panicum miliaceum  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus chachiensis | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus wilsonii | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| - | - | Lobivia bachenbergii | Ref. |
| - | - | Lobivia binghamiana | Ref. |
| - | - | Lobivia pentlandii | Ref. |
| - | - | Pseudolobivia kermesina | Ref. |
| - | - | Testulea gabonensis | Ref. |
|
|
zoom in
| Organism | Aloe ruspoliana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|