| Name |
Heliotrine N-oxide Heliotrine oxide |
| Formula |
C16H27NO6 |
| Mw |
329.1838376 |
| CAS RN |
6209-65-0 |
| C_ID |
C00026201
, 
|
| InChIKey |
QSTHEUSPIBEICI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H27NO6/c1-10(2)16(20,11(3)22-4)15(19)23-9-12-5-7-17(21)8-6-13(18)14(12)17/h5,10-11,13-14,18,20H,6-9H2,1-4H3/t11-,13+,14-,16+,17+/m1/s1 |
| SMILES |
COC(C)C(O)(C(=O)OCC1=CC[N+]2([O-])CCC(O)C12)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Xylariaceae | Hypoxylon disciforme | Ref. |
| Plantae | Boraginaceae | Heliotropium acutiflorum | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium dasycarpum | Ref. |
| Plantae | Boraginaceae | Heliotropium dissitiflorum | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium europeum | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
| Plantae | Boraginaceae | Heliotropium transoxanum | Ref. |
|
|
zoom in
| Organism | Heliotropium dissitiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|