| Name |
3alpha-Benzoyloxytropane Benzoyltropine O-Benzoyltropine |
| Formula |
C15H19NO2 |
| Mw |
245.14157886 |
| CAS RN |
19145-60-9 |
| C_ID |
C00025552
, 
|
| InChIKey |
XQJMXPAEFMWDOZ-WDNDVIMCNA-N |
| InChICode |
InChI=1S/C15H19NO2/c1-16-12-7-8-13(16)10-14(9-12)18-15(17)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+,14- |
| SMILES |
CN1[C@@H]2CC[C@H]1C[C@@H](OC(=O)c1ccccc1)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum argentinum O.E.Schulz | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ellipticum R.Br. | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum hypericifolium Lam.  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum sideroxyloides Lam. | Ref. |
| Plantae | Rhizophoraceae | Bruguiera exaristata Ding Hou | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula (Lour.) poir. | Ref. |
| Plantae | Rhizophoraceae | Crossostylis sebertii | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|