| Name |
Lepenine |
| Formula |
C22H33NO3 |
| Mw |
359.24604393 |
| CAS RN |
111524-32-4 |
| C_ID |
C00024925
, 
|
| InChIKey |
DHFGSUNKOXDUNF-YWUCRBDVNA-N |
| InChICode |
InChI=1S/C22H33NO3/c1-4-23-10-20(3)7-6-15(24)22-14(20)9-13(18(22)23)21-8-5-12(11(2)19(21)26)16(25)17(21)22/h12-19,24-26H,2,4-10H2,1,3H3/t12-,13+,14-,15+,16+,17-,18-,19-,20+,21+,22-/m1/s1 |
| SMILES |
C=C1[C@H]2CC[C@]3([C@@H]1O)[C@H]1C[C@@H]4C5(C)CC[C@H](O)C4([C@@H]1N(CC)C5)[C@@H]3[C@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum barbatum | Ref. |
| Plantae | Ranunculaceae | Aconitum kirinense Nakai | Ref. |
| Plantae | Ranunculaceae | Aconitum kusnezoffii  | Ref. |
| Plantae | Ranunculaceae | Aconitum leucostomum Worosch. | Ref. |
| Plantae | Ranunculaceae | Aconitum pseudohuiliense | Ref. |
|
|
zoom in
| Organism | Aconitum pseudohuiliense | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Feng, et al., Zhongguo Yaoke Daxue Xuebao, 34, (2003), 17 |
|---|
|