| Name |
Ergosta-5,7,22,24(28)-tetraen-3beta-ol Ergosta-5-7-22-24(28)-tetraen-3beta-ol |
| Formula |
C28H42O |
| Mw |
394.32356596 |
| CAS RN |
29560-24-5 |
| C_ID |
C00023764
, 
|
| InChIKey |
SQFQJKZSFOZDJY-GFPNMKOPNA-N |
| InChICode |
InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18,20,22,24-26,29H,3,11-17H2,1-2,4-6H3/b8-7+/t20-,22+,24-,25+,26+,27+,28-/m1/s1 |
| SMILES |
C=C(/C=C/[C@@H](C)C1CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
| Fungi | Saccharomycetaceae | Candida albicans | Ref. |
| Fungi | Saccharomycetaceae | Candida utilis | Ref. |
| Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
| Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
|
|
zoom in
| Organism | Aspergillus oryzae | | Reference | Barton,J.Chem.Soc.,Perkin Trans,1,(1972),513-522
Nes,Evidence for Similarities and Differences in the Biosynthesis of Fungal Sterols
Steroids,53,(1989),533-558
Turner,Fungal Metabolites II
Academic Press,New York,NY,316 pp.(1983) |
|---|
|