| Name |
Lathosterol Cholest-7-en-3beta-ol |
| Formula |
C27H46O |
| Mw |
386.35486609 |
| CAS RN |
80-99-9 |
| C_ID |
C00023744
, 
|
| InChIKey |
IZVFFXVYBHFIHY-HVTBQBQDNA-N |
| InChICode |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h10,18-21,23-25,28H,6-9,11-17H2,1-5H3/t19-,20-,21+,23-,24+,25+,26+,27-/m1/s1 |
| SMILES |
CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CCC4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Hypocreaceae | Nectria galligena | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| - | - | Blastocladia ramosa | Ref. |
| - | - | Dictyuchus monosporus | Ref. |
|
|
zoom in
| Organism | Dictyuchus monosporus | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function of Sterols in Fungi,Advances in Lipid Rese |
|---|
|