| Name |
Geranyl linalool Geranyllinalool (E,E)-Geranyllinalool geranyllinalool |
| Formula |
C20H34O |
| Mw |
290.26096571 |
| CAS RN |
1113-21-9 |
| C_ID |
C00022109
, 
|
| InChIKey |
IQDXAJNQKSIPGB-HQSZAHFGNA-N |
| InChICode |
InChI=1S/C20H34O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h7,11,13,15,21H,1,8-10,12,14,16H2,2-6H3/b18-13+,19-15+/t20-/m1/s1 |
| SMILES |
C=CC(C)(O)CC/C=C(C)CC/C=C(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Pinaceae | Pinus pinaster  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|