| Name |
Ptaquiloside Braxin C |
| Formula |
C20H30O8 |
| Mw |
398.19406794 |
| CAS RN |
87625-62-5 |
| C_ID |
C00021448
, 
|
| InChIKey |
GPHSJPVUEZFIDE-OBJSXLPANA-N |
| InChICode |
InChI=1S/C20H30O8/c1-9-6-20(28-17-15(25)14(24)13(23)11(8-21)27-17)7-10(2)19(4-5-19)18(3,26)16(20)12(9)22/h7,9,11,13-17,21,23-26H,4-6,8H2,1-3H3/t9-,11-,13-,14+,15-,16-,17+,18+,20+/m1/s1 |
| SMILES |
CC1=C[C@]2(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)C[C@@H](C)C(=O)[C@@H]2[C@](C)(O)C12CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cbotiaceae/Dicksoniaceae | Cibotium borometz | Ref. |
| Plantae | Dennstaedtiaceae | Dennstaedtia scabra | Ref. |
| Plantae | Dennstaedtiaceae | Histiopteris incisa | Ref. |
| Plantae | Dennstaedtiaceae | Hypolepis punctata | Ref. |
| Plantae | Dennstaedtiaceae | Microlepia strigosa | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Monachosoraceae | Monachosorum flagellare | Ref. |
| Plantae | Pteridaceae | Pteris cretica | Ref. |
|
|
zoom in
| Organism | Microlepia strigosa | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Saito, et al., Phytochemistry, 26, (1989), 1605.
Natori, J of Natural Medicines(Japan), 45, (1991), 175.
Ojika, et al., Tetrahedron, 43, (1987), 5261
5275.
Saito, et al., Phytochemistry, 29, (1990), 1475 |
|---|
|