| Name |
Matricarin Austricin acetate |
| Formula |
C17H20O5 |
| Mw |
304.13107375 |
| CAS RN |
5989-43-5 |
| C_ID |
C00020818
, 
|
| InChIKey |
QONYNSMAVSRIRD-OFOLENADNA-N |
| InChICode |
InChI=1S/C17H20O5/c1-7-5-11(19)13-8(2)6-12(21-10(4)18)15-9(3)17(20)22-16(15)14(7)13/h5,9,12,14-16H,6H2,1-4H3/t9-,12-,14-,15+,16+/m0/s1 |
| SMILES |
CC(=O)O[C@H]1CC(C)=C2C(=O)C=C(C)[C@@H]2[C@H]2OC(=O)[C@@H](C)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea collina  | Ref. |
| Plantae | Asteraceae | Achillea collina J.Becker ex Reichenb  | Ref. |
| Plantae | Asteraceae | Achillea lanulosa | Ref. |
| Plantae | Asteraceae | Artemisia tilesii | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Taraxacum bessarabicum (Hornem.) Hand-Mazz. | Ref. |
|
|
zoom in
| Organism | Chamomilla rectita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|