| Name |
Erythrodiol 3beta-Erythrodiol |
| Formula |
C30H50O2 |
| Mw |
442.38108084 |
| CAS RN |
545-48-2 |
| C_ID |
C00019065
, 
|
| InChIKey |
PSZDOEIIIJFCFE-OGEFKVSENA-N |
| InChICode |
InChI=1S/C30H50O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22-,23-,24+,27+,28-,29-,30-/m1/s1 |
| SMILES |
CC1(C)CC[C@]2(CO)CC[C@]3(C)C(=CCC4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@]43C)C2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Asteraceae | Conyza canadensis  | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Celastraceae | Maytenus ilicifolia  | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum passerinum | Ref. |
| Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina variegata L.  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Putranjivaceae | Drypetes molunduana Pax and Hoffm | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| - | - | Erythroxylon novogranatense | Ref. |
| - | - | Lemaireocereus longispinus | Ref. |
|
|
zoom in
| Organism | Terminalia brasiliensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|