| Name |
Gnetin H |
| Formula |
C42H32O9 |
| Mw |
680.20463262 |
| CAS RN |
105132-92-1 |
| C_ID |
C00015780
, 
|
| InChIKey |
PHIHHTIYURVLDB-QNVHYEFLNA-N |
| InChICode |
InChI=1S/C42H32O9/c43-27-8-1-22(2-9-27)3-14-34-39-35(50-41(23-4-10-28(44)11-5-23)37(39)25-15-30(46)19-31(47)16-25)21-36-40(34)38(26-17-32(48)20-33(49)18-26)42(51-36)24-6-12-29(45)13-7-24/h1-21,37-38,41-49H/b14-3+/t37-,38-,41+,42+/m0/s1 |
| SMILES |
Oc1ccc(/C=C/c2c3c(cc4c2[C@H](c2cc(O)cc(O)c2)[C@@H](c2ccc(O)cc2)O4)O[C@H](c2ccc(O)cc2)[C@H]3c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis chunganensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis heyneana | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
| Plantae | Welwitschiaceae | Welwitschia mirabilis | Ref. |
|
|
zoom in
| Organism | Vitis heyneana |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
