| Name |
Isorhamnetin 3-(2G-rhamnosylrutinoside)-7-rhamnoside Quercetin 3'-methyl ether 3-(2G-rhamnosylrutinoside)-7-rhamnoside 3-[(O-6-Deoxy-alpha-L-mannopyranosyl-(1->2)-O-[6-deoxy-alpha-L-mannopyranosyl-(1->6)]-beta-D-glucopyranosyl)oxy]-7-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C40H52O24 |
| Mw |
916.28485259 |
| CAS RN |
154171-32-1 |
| C_ID |
C00013919
, 
|
| InChIKey |
RFGSFRBMLXKAEM-PVITXCSKNA-N |
| InChICode |
InChI=1S/C40H52O24/c1-11-22(43)27(48)31(52)37(57-11)56-10-20-25(46)30(51)36(64-39-33(54)29(50)24(45)13(3)59-39)40(62-20)63-35-26(47)21-17(42)8-15(60-38-32(53)28(49)23(44)12(2)58-38)9-19(21)61-34(35)14-5-6-16(41)18(7-14)55-4/h5-9,11-13,20,22-25,27-33,36-46,48-54H,10H2,1-4H3/t11-,12-,13-,20-,22-,23-,24-,25-,27+,28+,29+,30-,31-,32-,33-,36+,37+,38-,39-,40-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O[C@@H]4OC(C)[C@H](O)C(O)[C@@H]4O)cc(O)c3c(=O)c2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)C(O)[C@@H]3O)[C@@H](O)[C@H](O)C2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Larrea divaricata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|