| Name |
(-)-Isoborneol L-Isoborneol (-)-Isoborneol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
10334-13-1 |
| C_ID |
C00011022
, 
|
| InChIKey |
DTGKSKDOIYIVQL-DXYSPLONNA-N |
| InChICode |
InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10?/m1/s1 |
| SMILES |
CC1(C)C2CC[C@]1(C)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea filipendulina | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Dipterocarpaceae | Dryobalanops aromatica  | Ref. |
| Plantae | Poaceae | Cymbopogon goeringii | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|