| Name |
2,5-Dihydroxy-p-cymene Hydrothymoquinone Thymohydroquinone |
| Formula |
C10H14O2 |
| Mw |
166.09937969 |
| CAS RN |
2217-60-9 |
| C_ID |
C00010862
, 
|
| InChIKey |
OQIOHYHRGZNZCW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,11-12H,1-3H3 |
| SMILES |
Cc1cc(O)c(C(C)C)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium japonicum | Ref. |
| Plantae | Cupressaceae | Juniperus chinensis | Ref. |
| Plantae | Cupressaceae | Libocedrus decurrens | Ref. |
| Plantae | Labiatae | Monarda spp. | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
|
|
zoom in
| Organism | Nigella sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|