| Name |
Melittoside |
| Formula |
C21H32O15 |
| Mw |
524.17412036 |
| CAS RN |
19467-03-9 |
| C_ID |
C00010621
, 
|
| InChIKey |
LZKBAGSBRBMVBE-JYMIVIIGNA-N |
| InChICode |
InChI=1S/C21H32O15/c22-4-7-3-10(25)21(36-20-17(31)15(29)13(27)9(6-24)34-20)1-2-32-18(11(7)21)35-19-16(30)14(28)12(26)8(5-23)33-19/h1-3,8-20,22-31H,4-6H2/t8-,9-,10-,11?,12-,13-,14-,15+,16+,17+,18-,19+,20+,21+/m1/s1 |
| SMILES |
OCC1=C[C@@H](O)[C@]2(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)C=COC(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Clerodendrum thomsonae | Ref. |
| Plantae | Labiatae | Melittis melissophyllum  | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago maritima  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Plantago subulata | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Plantago major | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|