| Name |
Hastatoside |
| Formula |
C17H24O11 |
| Mw |
404.13186161 |
| CAS RN |
50816-24-5 |
| C_ID |
C00010576
, 
|
| InChIKey |
PRZVXHGUJJPSME-BAUBQZSVNA-N |
| InChICode |
InChI=1S/C17H24O11/c1-6-3-9(19)17(24)7(14(23)25-2)5-26-15(10(6)17)28-16-13(22)12(21)11(20)8(4-18)27-16/h5-6,8,10-13,15-16,18,20-22,24H,3-4H2,1-2H3/t6-,8+,10-,11+,12-,13-,15+,16+,17+/m0/s1 |
| SMILES |
COC(=O)C1=COC(O[C@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@@H]2[C@@H](C)CC(=O)[C@]12O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Plantaginaceae | Penstemon grandiflorus | Ref. |
| Plantae | Plantaginaceae | Penstemon secundiflorus | Ref. |
| Plantae | Verbenaceae | Verbena bonariensis | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena hastata | Ref. |
| Plantae | Verbenaceae | Verbena officinalis | Ref. |
|
|
zoom in
| Organism | Verbena brasiliensis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
