| Name |
Genistein 7-O-beta-D-glucoside 6''-O-malonate Genistein 7-O-glucoside-6''-malonate Malonylgenistin |
| Formula |
C24H22O13 |
| Mw |
518.10604079 |
| CAS RN |
51011-05-3 |
| C_ID |
C00010110
, 
|
| InChIKey |
FRAUJUKWSKMNJY-JYQXBKEGNA-N |
| InChICode |
InChI=1S/C24H22O13/c25-11-3-1-10(2-4-11)13-8-34-15-6-12(5-14(26)19(15)20(13)30)36-24-23(33)22(32)21(31)16(37-24)9-35-18(29)7-17(27)28/h1-6,8,16,21-26,31-33H,7,9H2,(H,27,28)/t16-,21+,22-,23+,24+/m0/s1 |
| SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
|
|
zoom in
| Organism | Trifolium subterraneum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Beck,Aust.J.Chem.,24,(1971),1509 |
|---|
|