| Name |
Pseudobaptigenin 7-O-glucoside Rothindin |
| Formula |
C22H20O10 |
| Mw |
444.10564686 |
| CAS RN |
63347-43-3 |
| C_ID |
C00010085
, 
|
| InChIKey |
GWACEFYEIOPAJV-OXFOAJKANA-N |
| InChICode |
InChI=1S/C22H20O10/c23-7-17-19(25)20(26)21(27)22(32-17)31-11-2-3-12-15(6-11)28-8-13(18(12)24)10-1-4-14-16(5-10)30-9-29-14/h1-6,8,17,19-23,25-27H,7,9H2/t17-,19-,20+,21-,22-/m1/s1 |
| SMILES |
O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Ormocarpum cochinchinense | Ref. |
| Plantae | Fabaceae | Rothia indica | Ref. |
| Plantae | Fabaceae | Thermopsis alterniflora | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
|
|
zoom in
| Organism | Rothia indica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Nair,Indian J.Chem.Sect.B,14,(1976),801 |
|---|
|