| Name |
2',4'-Dihydroxy-5,6-methylenedioxy-2-phenylbenzofuran 2-(2,4-Dihydroxyphenyl)-5,6-methylenedioxybenzofuran |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
67121-26-0 |
| C_ID |
C00009802
, 
|
| InChIKey |
UACAJEAOMACMMU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-1-2-10(11(17)5-9)13-3-8-4-14-15(19-7-18-14)6-12(8)20-13/h1-6,16-17H,7H2 |
| SMILES |
Oc1ccc(-c2cc3cc4c(cc3o2)OCO4)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia indica  | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Sophora fraseri | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Sophora tomentosa  | Ref. |
|
|
zoom in
| Organism | Sophora tomentosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Komatsu,Chem.Pharm.Bull.,26,(1978),1274 |
|---|
|