| Name |
4-Methoxymaackiain |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
2694-69-1 |
| C_ID |
C00009623
, 
|
| InChIKey |
UXAJJVDCDOFKCY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H14O6/c1-19-17-11(18)3-2-8-15-10(6-20-16(8)17)9-4-13-14(22-7-21-13)5-12(9)23-15/h2-5,10,15,18H,6-7H2,1H3/t10-,15-/m0/s1 |
| SMILES |
COc1c(O)ccc2c1OCC1c3cc4c(cc3OC21)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia spruceana | Ref. |
| Plantae | Fabaceae | Sophora franchetiana | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Trifolium hybridum  | Ref. |
| Plantae | Fabaceae | Ulex jussiaei | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Ulex parviflorus | Ref. |
|
|
zoom in
| Organism | Trifolium hybridum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Harper,J.Chem.Soc.C,(1969),1109
Ingham,Biochem.Syst.Ecol.,6,(1978),217 |
|---|
|