| Name |
3,9-Dihydroxypterocarpan Demethylmedicarpin |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
61135-91-9 |
| C_ID |
C00009610
, 
|
| InChIKey |
ODMIEGVTNZNSLD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O4/c16-8-2-4-11-13(5-8)18-7-12-10-3-1-9(17)6-14(10)19-15(11)12/h1-6,12,15-17H,7H2/t12-,15-/m1/s1 |
| SMILES |
Oc1ccc2c(c1)OC1c3ccc(O)cc3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina sandwicensis | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Psophocarpus tetragonolobus  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
| Organism | Melilotus alba | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Phytochem.,19,(1980),1203
Woodward,Physiol.Plant Pathol.,18,(1981),33 |
|---|
|