| Name |
6a,12-Didehydrosumatrol 6a,12a-Dehydro-alpha-toxicarol Villosol |
| Formula |
C23H20O7 |
| Mw |
408.12090299 |
| CAS RN |
60077-62-5 |
| C_ID |
C00009606
, 
|
| InChIKey |
STFNGWNFASVBRR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H20O7/c1-10(2)14-6-12-16(29-14)7-13(24)21-22(25)20-11-5-17(26-3)18(27-4)8-15(11)28-9-19(20)30-23(12)21/h5,7-8,14,24H,1,6,9H2,2-4H3/t14-/m1/s1 |
| SMILES |
C=C(C)C1Cc2c(cc(O)c3c(=O)c4c(oc23)COc2cc(OC)c(OC)cc2-4)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caprifoliaceae | Patrinia villosa | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Millettia brandisiana | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
|
|
zoom in
| Organism | Tephrosia villosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Sarma,Indian J.Chem.Sect.B,14,(1976),152 |
|---|
|