| Name |
Angustone A 5,7,2',4'-Tetrahydroxy-6,3'-diprenylisoflavone |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
90686-13-8 |
| C_ID |
C00009523
, 
|
| InChIKey |
KKFAKKIIFUFASS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-7-16-19(26)10-9-15(23(16)28)18-12-31-21-11-20(27)17(8-6-14(3)4)24(29)22(21)25(18)30/h5-6,9-12,26-29H,7-8H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)ccc(-c2coc3cc(O)c(CC=C(C)C)c(O)c3c2=O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus angustifolius  | Ref. |
|
|
zoom in
| Organism | Lupinus angustifolius | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Tahara,Phytochem.,23,(1984),1889 |
|---|
|