| Name |
Parvisoflavone A |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
50277-01-5 |
| C_ID |
C00009499
, 
|
| InChIKey |
FNSFANUGPIQSTR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-20(2)6-5-12-16(26-20)8-15(23)17-18(24)13(9-25-19(12)17)11-4-3-10(21)7-14(11)22/h3-9,21-23H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc(O)c3c(=O)c(-c4ccc(O)cc4O)coc23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Phaseolus aureus  | Ref. |
| Plantae | Fabaceae | Poecilanthe parviflora | Ref. |
|
|
zoom in
| Organism | Poecilanthe parviflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Assumpcao,Phytochem.,12,(1973),1188 |
|---|
|