| Name |
Cabreuvin 7,3',4'-Trimethoxyisoflavone |
| Formula |
C18H16O5 |
| Mw |
312.09977362 |
| CAS RN |
1621-61-0 |
| C_ID |
C00009405
, 
|
| InChIKey |
UKWLNMIPRJLYGH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O5/c1-20-12-5-6-13-16(9-12)23-10-14(18(13)19)11-4-7-15(21-2)17(8-11)22-3/h4-10H,1-3H3 |
| SMILES |
COc1ccc2c(=O)c(-c3ccc(OC)c(OC)c3)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Fabaceae | Calopogonium mucunoides | Ref. |
| Plantae | Fabaceae | Myrocarpus fastigiatus | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Myroxylon peruiferum  | Ref. |
|
|
zoom in
| Organism | Myroxylon peruiferum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Gottlieb,Anais Assoc.Quim.Bras.,18,(1959),89
Maranduba,Phytochem.,18,(1979),815 |
|---|
|