| Name |
2'-Hydroxydaidzein 7,2',4'-Trihydroxyisoflavone |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
7678-85-5 |
| C_ID |
C00009383
, 
|
| InChIKey |
ZCTNPCRBEWXCGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-8-1-3-10(13(18)5-8)12-7-20-14-6-9(17)2-4-11(14)15(12)19/h1-7,16-18H |
| SMILES |
O=c1c(-c2ccc(O)cc2O)coc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Phaseolus vulgaris | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Woodward,Phytochem.,19,(1980),921 |
|---|
|