| Name |
Procyanidin B3
Catechin-(4alpha->8)-catechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
23567-23-9 |
| C_ID |
C00009071
, 
|
| InChIKey |
XFZJEEAOWLFHDH-KJNMLZBZNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula pubescens  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
| Plantae | Ericaceae | Calluna vulgaris | Ref. |
| Plantae | Ericaceae | Pyrola incarnata | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
| Plantae | Fabaceae | Arachis hypogaea | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Palmae | Areca catechu | Ref. |
| Plantae | Pinaceae | Larix gmelini | Ref. |
| Plantae | Pinaceae | Picea abies | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Fragaria spp. | Ref. |
| Plantae | Rosaceae | Potentilla viscosa | Ref. |
| Plantae | Rosaceae | Rosa cymosa | Ref. |
| Plantae | Rosaceae | Rosa henryi | Ref. |
| Plantae | Rosaceae | Rosa laevigata | Ref. |
| Plantae | Rosaceae | Rubus spp. | Ref. |
| Plantae | Rubiaceae | Uncaria gambir | Ref. |
| Plantae | Salicaceae | Populus canescens | Ref. |
| Plantae | Salicaceae | Salix caprea | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
| Plantae | Saxifragaceae | Bergenia purpurascens | Ref. |
| Plantae | Theaceae | Camellia japonica | Ref. |
| Plantae | Theaceae | Camellia sinensis var.assamica | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Vaccinium vitis-idaea |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin Trans.,1,(1972),1387
Chen, et al., Lexicon of Active Componentsin in Plants, Vol 3, Medicinal Science and Technology Press of China, Beijing, (2001).
Lou, et al., Phytochemistry, 65, (2004), 2391 |
|---|
|
