| Name |
Procyanidin B6 Catechin-(4alpha->6)-catechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
12798-58-2 |
| C_ID |
C00009070
, 
|
| InChIKey |
GMISZFQPFDAPGI-VUEAOWRWNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2/t21-,26+,28-,29+,30+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc2c(c1O)C[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus radiata | Ref. |
| Plantae | Pinaceae | Pinus sylvestris  | Ref. |
| Plantae | Rosaceae | Fragaria spp. | Ref. |
| Plantae | Rosaceae | Rosa cymosa | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Pinus radiata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Fletcher,J.Chem.Soc.Perkin Trans.,1,(1977),1628 |
|---|
|