| Name |
Fisetinidol-4alpha-ol |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
967-27-1 |
| C_ID |
C00008996
, 
|
| InChIKey |
OFZBQQUVMQGHDJ-QRSVUVFUNA-N |
| InChICode |
InChI=1S/C15H14O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,13-20H/t13-,14+,15-/m1/s1 |
| SMILES |
Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia cultriformis | Ref. |
| Plantae | Fabaceae | Acacia mearnsii  | Ref. |
| Plantae | Fabaceae | Acacia saxatilis | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Guibourtia coleosperma  | Ref. |
|
|
zoom in
| Organism | Guibourtia coleosperma | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
du Preez,J.Chem.Soc.C.,(1970),1800 |
|---|
|