| Name |
Dihydromorin |
| Formula |
C15H12O7 |
| Mw |
304.05830274 |
| CAS RN |
18422-83-8 |
| C_ID |
C00008570
, 
|
| InChIKey |
QIWOFDHUQPJCJF-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15-/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)cc2O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus dadah  | Ref. |
| Plantae | Moraceae | Artocarpus spp. | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
| Plantae | Moraceae | Maclura tinctoria  | Ref. |
| Plantae | Moraceae | Morus spp. | Ref. |
|
|
zoom in
| Organism | Maclura pomifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 689,Flavanones and dihydroflavonols
Carruhers,J.Chem.Soc.,(1957),4440
Laidlaw,Chem.Ind.(London),(1959),1604 |
|---|
|