| Name |
Sigmoidin B |
| Formula |
C20H20O6 |
| Mw |
356.12598837 |
| CAS RN |
87746-47-2 |
| C_ID |
C00008318
, 
|
| InChIKey |
SFQIGPZCFNTPOD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(24)20(11)25)17-9-15(23)19-14(22)7-13(21)8-18(19)26-17/h3,5-8,17,21-22,24-25H,4,9H2,1-2H3/t17-/m0/s1 |
| SMILES |
CC(C)=CCc1cc(C2CC(=O)c3c(O)cc(O)cc3O2)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 431,Flavanones and dihydroflavonols
Fomum,Tetrahedron Lett.,24,(1983),4127
Jia,Yaoxue Xuebao,26,(1991),758 |
|---|
|