| Name |
5,4'-Dihydroxy-6,7,8-trimethoxyflavanone |
| Formula |
C18H18O7 |
| Mw |
346.10525293 |
| CAS RN |
75933-09-4 |
| C_ID |
C00008257
, 
|
| InChIKey |
TZVHQZKWRMUZBY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H18O7/c1-22-16-14(21)13-11(20)8-12(9-4-6-10(19)7-5-9)25-15(13)17(23-2)18(16)24-3/h4-7,12,19,21H,8H2,1-3H3/t12-/m0/s1 |
| SMILES |
COc1c(O)c2c(c(OC)c1OC)OC(c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
|
|
zoom in
| Organism | Origanum microphyllum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|