| Name |
Farrerol (-)-Farrerol |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
24211-30-1 |
| C_ID |
C00008239
, 
|
| InChIKey |
DYHOLQACRGJEHX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-8-15(20)9(2)17-14(16(8)21)12(19)7-13(22-17)10-3-5-11(18)6-4-10/h3-6,13,18,20-21H,7H2,1-2H3/t13-/m1/s1 |
| SMILES |
Cc1c(O)c(C)c2c(c1O)C(=O)CC(c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Pancratium maritimum L. | Ref. |
| Plantae | Dryopteridaceae | Cyrtomium spp. | Ref. |
| Plantae | Ericaceae | Rhododendron dauricum  | Ref. |
| Plantae | Ericaceae | Rhododendron farrerae | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Hemerocallidaceae | Phormium tenax  | Ref. |
| Plantae | Myrtaceae | Angophora lanceolata | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Rhododendron spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 345,Flavanones and dihydroflavonols
Birch,J.Chem.Soc.,(1960),2063 |
|---|
|