| Name |
Naringenin 7-O-(6''-O-trans-coumaroyl)glucoside Prunin 6''-p-coumarate |
| Formula |
C30H28O12 |
| Mw |
580.15807636 |
| CAS RN |
96686-70-3 |
| C_ID |
C00008211
, 
|
| InChIKey |
PLORCKNHUZJPKH-ONEMPUCINA-N |
| InChICode |
InChI=1S/C30H28O12/c31-17-6-1-15(2-7-17)3-10-25(35)39-14-24-27(36)28(37)29(38)30(42-24)40-19-11-20(33)26-21(34)13-22(41-23(26)12-19)16-4-8-18(32)9-5-16/h1-12,22,24,27-33,36-38H,13-14H2/b10-3+/t22-,24+,27+,28-,29-,30+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc(O)c3c(c2)OC(c2ccc(O)cc2)CC3=O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Blepharis sindica | Ref. |
| Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Anisomeles ovata | Ref. |
| Plantae | Labiatae | Phlomis aurea | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
|
|
zoom in
| Organism | Phlomis aurea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 313,Flavanones and dihydroflavonols
Rahman,Phytochem.,17,(1978),1064 |
|---|
|