| Name |
Dihydrooroxylin A 5,7-Dihydroxy-6-methoxyflavanone |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
18956-18-8 |
| C_ID |
C00008148
, 
|
| InChIKey |
QUAPPCXFYKSDSV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-6,8,12,18-19H,7H2,1H3/t12-/m0/s1 |
| SMILES |
COc1c(O)cc2c(c1O)C(=O)CC(c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus pumilio | Ref. |
| Plantae | Piperaceae | Piper sp.  | Ref. |
| Plantae | Piperaceae | Piper spp. | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
|
|
zoom in
| Organism | Piper spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 241,Flavanones and dihydroflavonols
Hansel,Planta Med.,15,(1967),443 |
|---|
|