| Name |
Maritimein |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
490-54-0 |
| C_ID |
C00008050
, 
|
| InChIKey |
SYRURBPRFQUYQS-OSYXLDHXNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-14-16(26)18(28)19(29)21(32-14)31-12-4-2-9-15(25)13(30-20(9)17(12)27)6-8-1-3-10(23)11(24)5-8/h1-6,14,16,18-19,21-24,26-29H,7H2/b13-6-/t14-,16-,18+,19-,21-/m1/s1 |
| SMILES |
O=C1C(=Cc2ccc(O)c(O)c2)Oc2c1ccc(O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)c2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens carpodonta | Ref. |
| Plantae | Asteraceae | Bidens ferulifolia | Ref. |
| Plantae | Asteraceae | Bidens longistyla | Ref. |
| Plantae | Asteraceae | Bidens pilosa  | Ref. |
| Plantae | Asteraceae | Coreopsis bigelovii | Ref. |
| Plantae | Asteraceae | Coreopsis gigantea | Ref. |
| Plantae | Asteraceae | Coreopsis maritima | Ref. |
| Plantae | Asteraceae | Coreopsis tinctoria | Ref. |
| Plantae | Asteraceae | Simsia ghiesbreghtii | Ref. |
| Plantae | Asteraceae | Zinnia linearis | Ref. |
|
|
zoom in
| Organism | Bidens pilosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Harborne,J.Am.Chem.Soc.,78,(1956),829
Shimokoriyama,J.Am.Chem.Soc.,79,(1957),214 |
|---|
|