| Name |
2',4'-Dihydroxy-4,6'-dimethoxydihydrochalcone |
| Formula |
C17H18O5 |
| Mw |
302.11542369 |
| CAS RN |
75679-58-2 |
| C_ID |
C00007940
, 
|
| InChIKey |
SGAQUVXWXIVPKX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H18O5/c1-21-13-6-3-11(4-7-13)5-8-14(19)17-15(20)9-12(18)10-16(17)22-2/h3-4,6-7,9-10,18,20H,5,8H2,1-2H3 |
| SMILES |
COc1ccc(CCC(=O)c2c(O)cc(O)cc2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Goniothalamus gardneri | Ref. |
| Plantae | Myristicaceae | Iryanthera grandis | Ref. |
| Plantae | Myristicaceae | Iryanthera juruensis  | Ref. |
| Plantae | Myristicaceae | Iryanthera laevis | Ref. |
| Plantae | Myristicaceae | Iryanthera paraensis | Ref. |
| Plantae | Myristicaceae | Iryanthera sagotiana | Ref. |
|
|
zoom in
| Organism | Iryanthera paraensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Braz Filho,Phytochem.,19,(1980),1195
Vieira,Phytochem.,22,(1983),2281 |
|---|
|