| Name |
Derricidin |
| Formula |
C20H20O3 |
| Mw |
308.1412445 |
| CAS RN |
38965-74-1 |
| C_ID |
C00007053
, 
|
| InChIKey |
DGUGLZYULGVSIZ-DHZHZOJOSA-N |
| InChICode |
InChI=1S/C20H20O3/c1-15(2)12-13-23-17-9-10-18(20(22)14-17)19(21)11-8-16-6-4-3-5-7-16/h3-12,14,22H,13H2,1-2H3/b11-8+ |
| SMILES |
CC(C)=CCOc1ccc(C(=O)/C=C/c2ccccc2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris floribunda  | Ref. |
| Plantae | Fabaceae | Derris sericea | Ref. |
| Plantae | Fabaceae | Lonchocarpus guatemalensis | Ref. |
| Plantae | Fabaceae | Lonchocarpus neuroscapha | Ref. |
| Plantae | Fabaceae | Lonchocarpus xuul | Ref. |
| Plantae | Fabaceae | Millettia erythrocalyx | Ref. |
|
|
zoom in
| Organism | Lonchocarpus xuul |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
do Nascimento,Phytochem.,11,(1972),3023 |
|---|
|
