| Name |
Aurentiacin A |
| Formula |
C17H16O4 |
| Mw |
284.104859 |
| CAS RN |
60433-78-5 |
| C_ID |
C00007040
, 
|
| InChIKey |
PVTAUQXAGOXGNJ-CMDGGOBGSA-N |
| InChICode |
InChI=1S/C17H16O4/c1-11-14(19)10-15(20)16(17(11)21-2)13(18)9-8-12-6-4-3-5-7-12/h3-10,19-20H,1-2H3/b9-8+ |
| SMILES |
COc1c(C)c(O)cc(O)c1C(=O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalea scandens | Ref. |
| Plantae | Gesneriaceae | Didymocarpus aurantiaca | Ref. |
| Plantae | Gesneriaceae | Didymocarpus aurentiacum | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
|
|
zoom in
| Organism | Myrica pensylvanica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Adityachaudhury,Plant Biochem.J.,2,(1975),65
Dominguez,Phytochem.,19,(1980),1262 |
|---|
|