| Name |
3,4,2',4',alpha-Pentahydroxychalcone |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
38681-20-8 |
| C_ID |
C00006978
, 
|
| InChIKey |
XYPWLRSMRXLPRF-NSIKDUERSA-N |
| InChICode |
InChI=1S/C15H12O6/c16-9-2-3-10(12(18)7-9)15(21)14(20)6-8-1-4-11(17)13(19)5-8/h1-7,16-20H/b14-6- |
| SMILES |
O=C(/C(O)=C/c1ccc(O)c(O)c1)c1ccc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Hymenaea verrucosa | Ref. |
| Plantae | Fabaceae | Peltogyne paniculata | Ref. |
| Plantae | Fabaceae | Peltogyne pubescens | Ref. |
| Plantae | Fabaceae | Peltogyne venosa | Ref. |
| Plantae | Fabaceae | Trachylobium verrucosum | Ref. |
|
|
zoom in
| Organism | Trachylobium verrucosum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Ferreira,J.Chem.Soc.,Perkin Trans.,1,(1974),1492
Malan,Phytochem.,13,(1974),1575 |
|---|
|