| Name |
2',6'-Dihydroxy-4'-methoxychalcone
Pinostrobin chalcone |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
18956-15-5 |
| C_ID |
C00006934
, 
|
| InChIKey |
CUGDOWNTXKLQMD-BQYQJAHWSA-N |
| InChICode |
InChI=1S/C16H14O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-10,18-19H,1H3/b8-7+ |
| SMILES |
COc1cc(O)c(C(=O)/C=C/c2ccccc2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Lauraceae | Lindera umbellata | Ref. |
| Plantae | Piperaceae | Piper aduncum | Ref. |
| Plantae | Piperaceae | Piper hispidum | Ref. |
| Plantae | Pteridaceae | Onychium siliculosum | Ref. |
| Plantae | Pteridaceae | Pityrogramma chrysophylla | Ref. |
| Plantae | Pteridaceae | Pityrogramma tartarea | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl. | Ref. |
|
|
zoom in
| Organism | Piper hispidum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Nilsson,Acta Chem.Scand.,15,(1961),211
Hayashi,Chem.Ind.(London),(1969),1779 |
|---|
|
