| Name |
Malvidin 3-rhamnoside-5-glucoside |
| Formula |
C29H35O16 |
| Mw |
639.19251007 |
| CAS RN |
53925-29-4 |
| C_ID |
C00006741
, 
|
| InChIKey |
GNUHZLJAPZCZJW-QCYOUXFDNA-O |
| InChICode |
InChI=1S/C29H34O16/c1-10-20(32)23(35)25(37)28(41-10)44-18-8-13-14(42-27(18)11-4-16(39-2)21(33)17(5-11)40-3)6-12(31)7-15(13)43-29-26(38)24(36)22(34)19(9-30)45-29/h4-8,10,19-20,22-26,28-30,32,34-38H,9H2,1-3H3,(H-,31,33)/p+1/t10-,19+,20+,22-,23-,24+,25+,26+,28+,29-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3cc2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
| Plantae | Fabaceae | Lathyrus latifolius | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia deflexa | Ref. |
| Plantae | Fabaceae | Vicia pseudo-orobus  | Ref. |
| Plantae | Fabaceae | Vicia unijuga  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
|
|
zoom in
| Organism | Vicia deflexa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85
Statham,Phytochem.,11,(1972),1083 |
|---|
|