| Name |
Cyanidin 3-O-beta-D-galactopyranoside Idaein Cyanidin 3-galactoside Cyanidin 3-O-galactoside |
| Formula |
C21H21O11 |
| Mw |
449.10838652 |
| CAS RN |
27661-36-5 |
| C_ID |
C00006652
, 
|
| InChIKey |
RKWHWFONKJEUEF-PNSIFLDANA-O |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17+,18+,19-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Pistacia vera  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Celastraceae | Euonymus europaea  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus mas  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
| Plantae | Ericaceae | Arbutus unedo  | Ref. |
| Plantae | Ericaceae | Gaylussacia spp. | Ref. |
| Plantae | Ericaceae | Vaccinium arboreum Marsh. | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus L.  | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Euphorbiaceae | Acalypha hispida  | Ref. |
| Plantae | Fagaceae | Fagus sylvatica  | Ref. |
| Plantae | Hippuridaceae | Hippuris vulgaris | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea candida  | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma plumbaginoides | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Rosaceae | Amelanchier turkestanica | Ref. |
| Plantae | Rosaceae | Chaenomeles speciosa  | Ref. |
| Plantae | Rosaceae | Malus sylvestris  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae | Camellia spp. | Ref. |
|
|
zoom in
| Organism | Asparagus racemosus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann,408,(1915),15
Timberlake,J.Sci.Food Agric.,22,(1971),509 |
|---|
|