| Name |
Isoginkgetin |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
548-19-6 |
| C_ID |
C00006494
, 
|
| InChIKey |
HUOOMAOYXQFIDQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-18-6-3-15(4-7-18)26-14-24(38)31-22(36)12-21(35)29(32(31)42-26)19-9-16(5-8-25(19)40-2)27-13-23(37)30-20(34)10-17(33)11-28(30)41-27/h3-14,33-36H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc(-c5cc(=O)c6c(O)cc(O)cc6o5)ccc4OC)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Boweniaceae | Bowenia spp. | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Decussocarpus spp. | Ref. |
| Plantae | Podocarpaceae | Halocarpus spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus elongatus | Ref. |
| Plantae | Podocarpaceae | Podocarpus gracilior | Ref. |
| Plantae | Podocarpaceae | Podocarpus nagi  | Ref. |
| Plantae | Zamiaceae | Encephalartos spp. | Ref. |
| Plantae | Zamiaceae | Lepidozamia spp. | Ref. |
|
|
zoom in
| Organism | Decussocarpus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Baker,J.Chem.Soc.,(1963),1477 |
|---|
|