| Name |
7-O-methylamentoflavone Sequoiaflavone |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
21763-71-3 |
| C_ID |
C00006487
, 
|
| InChIKey |
TYUMAYSMJLPFAN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-39-17-9-20(34)29-23(37)12-26(40-27(29)10-17)15-4-7-19(33)18(8-15)28-21(35)11-22(36)30-24(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)c(-c4c(O)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Cupressus cashmeriana | Ref. |
| Plantae | Cupressaceae | Libocedrus bidwillii | Ref. |
| Plantae | Euphorbiaceae | Elateriospermum tapos  | Ref. |
| Plantae | Podocarpaceae | Podocarpus montanus | Ref. |
| Plantae | Taxodiaceae | Cryptomeria konishii | Ref. |
| Plantae | Taxodiaceae | Sequoia sempervirens | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Zamiaceae | Dioon spp. | Ref. |
| Plantae | Zamiaceae | Zamia angustifolia  | Ref. |
|
|
zoom in
| Organism | Cupressus cashmeriana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,J.Pharm.Soc.Japan,88,(1968),1489 |
|---|
|