| Name |
Spinosin |
| Formula |
C28H32O15 |
| Mw |
608.17412036 |
| CAS RN |
72063-39-9 |
| C_ID |
C00006268
, 
|
| InChIKey |
VGGSULWDCMWZPO-LRIMOGAENA-N |
| InChICode |
InChI=1S/C28H32O15/c1-39-14-7-15-18(12(32)6-13(40-15)10-2-4-11(31)5-3-10)22(35)19(14)26-27(24(37)21(34)16(8-29)41-26)43-28-25(38)23(36)20(33)17(9-30)42-28/h2-7,16-17,20-21,23-31,33-38H,8-9H2,1H3/t16-,17-,20-,21-,23+,24+,25-,26+,27-,28+/m1/s1 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Clutia abyssinica  | Ref. |
| Plantae | Euphorbiaceae | Strophioblachia fimbricalyx Boerl | Ref. |
| Plantae | Gentianaceae | Swertia spp. | Ref. |
| Plantae | Iridaceae | Iris nertshinskia | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Ziziphus spp. | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|