| Name |
Violanthin |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
40581-17-7 |
| C_ID |
C00006230
, 
|
| InChIKey |
MVOUGOXRXQDXDC-VKPDRIQKNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-8-17(31)21(35)23(37)27(39-8)16-20(34)15(26-24(38)22(36)18(32)13(7-28)41-26)19(33)14-11(30)6-12(40-25(14)16)9-2-4-10(29)5-3-9/h2-6,8,13,17-18,21-24,26-29,31-38H,7H2,1H3/t8-,13+,17-,18+,21-,22-,23+,24+,26-,27-/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](c2c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)C(O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Marattiaceae | Angiopteris evecta  | Ref. |
| Plantae | Poaceae | Eleusine spp. | Ref. |
| Plantae | Violaceae | Viola tricolor  | Ref. |
|
|
zoom in
| Organism | Viola tricolor | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Xing, et al., CCMM, 28, (2003), 593
Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Horhammer,Tetrahedron Lett.,(1965),1707
Kaneta,Agric.Biol.Chem.,37,(1973),2663 |
|---|
|