| Name |
Myricetin 3-(6''-galloylgalactoside) Myricetin-3-O-beta-D-(6''-O-galloyl)-galactopyranoside Myricetin-3-O-beta-D-(6''-O-galloyl)-glucopyranoside |
| Formula |
C28H24O17 |
| Mw |
632.10134934 |
| CAS RN |
56317-08-9 |
| C_ID |
C00006039
, 
|
| InChIKey |
FOMYLMGOSTVYEE-RLRYQNPYNA-N |
| InChICode |
InChI=1S/C28H24O17/c29-10-5-11(30)18-16(6-10)43-25(8-1-12(31)19(35)13(32)2-8)26(22(18)38)45-28-24(40)23(39)21(37)17(44-28)7-42-27(41)9-3-14(33)20(36)15(34)4-9/h1-6,17,21,23-24,28-37,39-40H,7H2/t17-,21+,23-,24+,28+/m1/s1 |
| SMILES |
O=C(OC[C@H]1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@H]1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum aizoon  | Ref. |
| Plantae | Crassulaceae | Sedum kamtschaticum  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
| Plantae | Lythraceae | Woodfordia fruticosa  | Ref. |
| Plantae | Onagraceae | Epilobium angustifolium  | Ref. |
| Plantae | Onagraceae | Epilobium dodona | Ref. |
| Plantae | Saxifragaceae | Tellima grandiflora | Ref. |
|
|
zoom in
| Organism | Woodfordia fruticosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Collins,Phytochem.,14,(1975),1099
Zapesochnaya,Khim.Prir.Soedin,(1978),806 |
|---|
|