| Name |
Kaempferol 3-(2'',4''-di-(E)-p-coumarylrhamnoside) |
| Formula |
C39H32O14 |
| Mw |
724.17920573 |
| CAS RN |
163434-73-9 |
| C_ID |
C00005868
, 
|
| InChIKey |
KMOHJUXDKSMQOG-ORLJHJONNA-N |
| InChICode |
InChI=1S/C39H32O14/c1-20-35(51-30(45)16-6-21-2-10-24(40)11-3-21)34(48)38(52-31(46)17-7-22-4-12-25(41)13-5-22)39(49-20)53-37-33(47)32-28(44)18-27(43)19-29(32)50-36(37)23-8-14-26(42)15-9-23/h2-20,34-35,38-44,48H,1H3/b16-6+,17-7+/t20-,34+,35-,38-,39-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@@H](OC(=O)/C=C/c2ccc(O)cc2)C(O)[C@H]1OC(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Archeria traversii | Ref. |
| Plantae | Ericaceae | Cyathodes empetrifolia | Ref. |
| Plantae | Ericaceae | Dracophyllum spp. | Ref. |
| Plantae | Ericaceae | Epacris alpina | Ref. |
| Plantae | Ericaceae | Epacris pauciflora | Ref. |
| Plantae | Ericaceae | Leucopogon spp. | Ref. |
| Plantae | Ericaceae | Pentachondra pumila | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Ocotea vellosiana | Ref. |
|
|
zoom in
| Organism | Epacris pauciflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bloor,Phytochem.,38,(1995),1033
Garcez,Phytochem.,39,(1995),815 |
|---|
|